* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRROLO[3,4-B]PYRIDINE |
CAS: | 656-38-2 |
English Synonyms: | 1H-PYRROLO[3,4-B]PYRIDINE |
MDL Number.: | MFCD13175179 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc-2cncc2[nH]c1 |
InChi: | InChI=1S/C7H6N2/c1-2-6-4-8-5-7(6)9-3-1/h1-5,9H |
InChiKey: | InChIKey=QJMCIPBZDVYHDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.