* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-CHLORO-1-METHYL-1H-INDOLE |
CAS: | 65610-58-4 |
English Synonyms: | 2-CHLORO-1-METHYL-1H-INDOLE |
MDL Number.: | MFCD13178516 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cn1c2ccccc2cc1Cl |
InChi: | InChI=1S/C9H8ClN/c1-11-8-5-3-2-4-7(8)6-9(11)10/h2-6H,1H3 |
InChiKey: | InChIKey=QLATXALTCNYKEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.