* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ALOZAFONE |
CAS: | 65899-72-1 |
English Synonyms: | ALOZAFONE |
MDL Number.: | MFCD00866990 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(CC#N)N(C)CC(=O)N(C)c1ccc(cc1C(=O)c2ccccc2F)Cl |
InChi: | InChI=1S/C21H21ClFN3O2/c1-14(10-11-24)25(2)13-20(27)26(3)19-9-8-15(22)12-17(19)21(28)16-6-4-5-7-18(16)23/h4-9,12,14H,10,13H2,1-3H3 |
InChiKey: | InChIKey=JHGHHEGZWJNCAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.