* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PERFLUOROHEX-1-ENE |
CAS: | 66249-21-6 |
English Synonyms: | 1H-PERFLUOROHEX-1-ENE |
MDL Number.: | MFCD16621325 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=C(\C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)/F)\F |
InChi: | InChI=1S/C6HF11/c7-1-2(8)3(9,10)4(11,12)5(13,14)6(15,16)17/h1H/b2-1+ |
InChiKey: | InChIKey=XBCWZRARCMLNAN-OWOJBTEDSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.