* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,5-/1,7-DIMETHYLPHENANTHRENE |
CAS: | 483-87-4 ;66271-87-2 |
English Synonyms: | 1,5-/1,7-DMP ; 1,5-/1,7-DIMETHYLPHENANTHRENE |
MDL Number.: | MFCD00216226 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(c1)ccc3c2cccc3C.Cc1cccc2c1ccc3c2c(ccc3)C |
InChi: | InChI=1S/2C16H14/c1-11-5-4-8-15-14(11)10-9-13-7-3-6-12(2)16(13)15;1-11-6-8-15-13(10-11)7-9-14-12(2)4-3-5-16(14)15/h2*3-10H,1-2H3 |
InChiKey: | InChIKey=ZMMHZUMXUYENQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.