* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-ALLYL-4-METHYL-PHENOL |
CAS: | 6628-06-4 |
English Synonyms: | 4-METHYL-2-(PROP-2-EN-1-YL)PHENOL ; 2-ALLYL-4-METHYL-PHENOL |
MDL Number.: | MFCD00037177 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)CC=C)O |
InChi: | InChI=1S/C10H12O/c1-3-4-9-7-8(2)5-6-10(9)11/h3,5-7,11H,1,4H2,2H3 |
InChiKey: | InChIKey=JVXJWGPWQBPZOI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.