* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,5'-BIIMIDAZO[1,2-A]PYRIDINE |
CAS: | 66358-13-2 |
English Synonyms: | 5,5'-BIIMIDAZO[1,2-A]PYRIDINE |
MDL Number.: | MFCD13183209 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc(n2ccnc2c1)c3cccc4n3ccn4 |
InChi: | InChI=1S/C14H10N4/c1-3-11(17-9-7-15-13(17)5-1)12-4-2-6-14-16-8-10-18(12)14/h1-10H |
InChiKey: | InChIKey=RAGWIEZNYRJZKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.