* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDANOMYCIN |
CAS: | 66513-28-8 |
English Synonyms: | X-14547A ; INDANOMYCIN |
MDL Number.: | MFCD00133416 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC[C@H]1CC[C@@H]2[C@@H]1C=C[C@H]([C@H]2C(=O)c3ccc[nH]3)/C=C/C=C(\CC)/[C@H]4[C@H](CC[C@@H](O4)[C@@H](C)C(=O)O)C |
InChi: | InChI=1S/C31H43NO4/c1-5-21-13-16-25-24(21)15-14-23(28(25)29(33)26-11-8-18-32-26)10-7-9-22(6-2)30-19(3)12-17-27(36-30)20(4)31(34)35/h7-11,14-15,18-21,23-25,27-28,30,32H,5-6,12-13,16-17H2,1-4H3,(H,34,35)/b10-7+,22-9+/t19-,20+,21-,23+,24+,25+,27+,28+,30+/m0/s1 |
InChiKey: | InChIKey=BAIPOTOKPGDCHA-MWBHXQFBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.