* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AZASPIRO[3.5]NONANE |
CAS: | 666-08-0 |
English Synonyms: | 2-AZASPIRO[3.5]NONANE |
MDL Number.: | MFCD11186836 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1CCC2(CC1)CNC2 |
InChi: | InChI=1S/C8H15N/c1-2-4-8(5-3-1)6-9-7-8/h9H,1-7H2 |
InChiKey: | InChIKey=IBODJKKYTBNWTD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.