* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-2,4,4'-triol |
CAS: | 66624-11-1 |
English Synonyms: | [1,1'-BIPHENYL]-2,4,4'-TRIOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C=1(C(=CC(=CC1)O)O)C1=CC=C(C=C1)O |
InChi: | InChI=1S/C12H10O3/c13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15/h1-7,13-15H |
InChiKey: | InChIKey=CDABMPUGYTZWIY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.