* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-PRO-ARG-PNA |
| CAS: | 66648-35-9 |
| English Synonyms: | Z-GLY-PRO-ARG-PNA |
| MDL Number.: | MFCD00083723 |
| H bond acceptor: | 15 |
| H bond donor: | 6 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(=N)N)C(=O)Nc3ccc(cc3)[N+](=O)[O-] |
| InChi: | InChI=1S/C27H34N8O7/c28-26(29)30-14-4-8-21(24(37)32-19-10-12-20(13-11-19)35(40)41)33-25(38)22-9-5-15-34(22)23(36)16-31-27(39)42-17-18-6-2-1-3-7-18/h1-3,6-7,10-13,21-22H,4-5,8-9,14-17H2,(H,31,39)(H,32,37)(H,33,38)(H4,28,29,30)/t21-,22-/m0/s1 |
| InChiKey: | InChIKey=ZPQZRIJTQNWNLG-VXKWHMMOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.