* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (5-BROMO-3-METHYL-1H-INDOL-2-YL)METHANOL |
CAS: | 666752-18-7 |
English Synonyms: | (5-BROMO-3-METHYL-1H-INDOL-2-YL)METHANOL |
MDL Number.: | MFCD11053994 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | Cc1c2cc(ccc2[nH]c1CO)Br |
InChi: | InChI=1S/C10H10BrNO/c1-6-8-4-7(11)2-3-9(8)12-10(6)5-13/h2-4,12-13H,5H2,1H3 |
InChiKey: | InChIKey=UXXWIWFJZKRNDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.