* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AZASPIRO[5.5]UNDEC-8-ENE |
CAS: | 6671-73-4 |
English Synonyms: | 2-AZASPIRO[5.5]UNDEC-8-ENE |
MDL Number.: | MFCD13179123 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1CC2(CCC=CC2)CNC1 |
InChi: | InChI=1S/C10H17N/c1-2-5-10(6-3-1)7-4-8-11-9-10/h1-2,11H,3-9H2 |
InChiKey: | InChIKey=OLDQPXDXLMZREX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.