* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (R)-(+)-3-METHYLCYCLOPENTANONE |
| CAS: | 6672-30-6 |
| English Synonyms: | (R)-(+)-3-METHYLCYCLOPENTANONE ; (3R)-3-METHYLCYCLOPENTAN-1-ONE |
| MDL Number.: | MFCD00064147 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C[C@@H]1CCC(=O)C1 |
| InChi: | InChI=1S/C6H10O/c1-5-2-3-6(7)4-5/h5H,2-4H2,1H3/t5-/m1/s1 |
| InChiKey: | InChIKey=AOKRXIIIYJGNNU-RXMQYKEDSA-N |
|
|
| Boiling Point: | 143-144 DEG C(LIT) |
| Density: | DENSITY: 0.914 G/ML AT 25 DEG C(LIT) |
| Physical Property: | FLASHPOINT: 37 DEG C FLASHPOINT: 98.6 DEG F REFRACTIVE INDEX: N20/D 1.434(LIT) |
| Comments: | OPTICAL ACTIVITY: [ALPHA]23/D +148 DEG, C = 4.5 IN METHANOL RIDADR: UN 1224 3/PG 3 UNSPSC: 12352100 WGK: 3 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.