* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ENDOTHERM ENA075 |
CAS: | 66774-70-7 |
English Synonyms: | ENDOTHERM ENA075 |
MDL Number.: | MFCD11100885 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C[C@H](CO)[C@H]1CCC2[C@@]1(CCC[C@@H]2OC(=O)c3ccccc3)C |
InChi: | InChI=1S/C20H28O3/c1-14(13-21)16-10-11-17-18(9-6-12-20(16,17)2)23-19(22)15-7-4-3-5-8-15/h3-5,7-8,14,16-18,21H,6,9-13H2,1-2H3/t14-,16-,17?,18+,20-/m1/s1 |
InChiKey: | InChIKey=YDGDTMZQDFVDCD-QPWMYVPMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.