Molecular Structure:
CAS No.:
66810-29-5
Product Name.:
CCD No.:CCD04084067
Formula:C4 H7 N O2 S
MolWeight:133.17
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 3-METHYL-3-NITROTHIETANE |
| CAS： | 66810-29-5 |
| English Synonyms： | 3-METHYL-3-NITROTHIETANE |
| MDL Number.： | MFCD18325186 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | CC1(CSC1)[N+](=O)[O-] |
| InChi： | InChI=1S/C4H7NO2S/c1-4(5(6)7)2-8-3-4/h2-3H2,1H3 |
| InChiKey： | InChIKey=RSGMGMVQGDWQIX-UHFFFAOYSA-N |
|
|
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
