* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,7-DIMETHYLINDAN |
CAS: | 6682-71-9 |
English Synonyms: | 4,7-DIMETHYLINDAN ; 4,7-DIMETHYL-2,3-DIHYDRO-1H-INDENE |
MDL Number.: | MFCD11223164 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cc1ccc(c2c1CCC2)C |
InChi: | InChI=1S/C11H14/c1-8-6-7-9(2)11-5-3-4-10(8)11/h6-7H,3-5H2,1-2H3 |
InChiKey: | InChIKey=IWHKMCQFAMHMSX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.