Molecular Structure:
CAS No.:
67008-97-3
Product Name.:
CCD No.:CCD03476986
Formula:C12 H14 N2 O2
MolWeight:218.255
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 6-METHYL-D-TRYPTOPHAN |
| CAS： | 67008-97-3 |
| English Synonyms： | ABLOCK AB-11-3542 ; 6-METHYL-D-TRYPTOPHAN ; D-TRYPTOPHAN, 6-METHYL- |
| MDL Number.： | MFCD17214436 |
| H bond acceptor： | 4 |
| H bond donor： | 3 |
| Smile： | Cc1ccc2c(c1)[nH]cc2C[C@H](C(=O)O)N |
| InChi： | InChI=1S/C12H14N2O2/c1-7-2-3-9-8(5-10(13)12(15)16)6-14-11(9)4-7/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChiKey： | InChIKey=GDMRVYIFGPMUCG-SNVBAGLBSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
