* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,2-DIMETHYLPIPERIDINE |
CAS: | 671-36-3 |
English Synonyms: | 1,2-DIMETHYLPIPERIDINE |
MDL Number.: | MFCD00023726 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC1CCCCN1C |
InChi: | InChI=1S/C7H15N/c1-7-5-3-4-6-8(7)2/h7H,3-6H2,1-2H3 |
InChiKey: | InChIKey=MWUISCCBFHLWLY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.