* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-BROMO-3,3-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE |
CAS: | 67159-84-6 |
English Synonyms: | 6-BROMO-3,3-DIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE ; 6-BROMO-3,3-DIMETHYL-INDAN-1-ONE |
MDL Number.: | MFCD17267475 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC1(CC(=O)c2c1ccc(c2)Br)C |
InChi: | InChI=1S/C11H11BrO/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5H,6H2,1-2H3 |
InChiKey: | InChIKey=YIFWUKQMDXTIFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.