* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHODAMINE S |
CAS: | 67226-84-0 |
English Synonyms: | RHODAMINE S |
MDL Number.: | MFCD00059989 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CN(C)c1ccc2c(c1)oc-3cc(=[N+](C)C)ccc3c2CCC(=O)O.[Cl-] |
InChi: | InChI=1S/C20H22N2O3.ClH/c1-21(2)13-5-7-16-15(9-10-20(23)24)17-8-6-14(22(3)4)12-19(17)25-18(16)11-13;/h5-8,11-12H,9-10H2,1-4H3;1H |
InChiKey: | InChIKey=PWRXRKRLQRNESS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.