* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | PYRAZOLO[1,5-A]PYRIMIDINE-5,7(4H,6H)-DIONE |
CAS: | 672323-32-9 ;57489-70-0 |
English Synonyms: | 4H,5H,6H,7H-PYRAZOLO[1,5-A]PYRIMIDINE-5,7-DIONE ; PYRAZOLO[1,5-A]PYRIMIDINE-5,7(4H,6H)-DIONE |
MDL Number.: | MFCD09953598 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cnn2c1NC(=O)CC2=O |
InChi: | InChI=1S/C6H5N3O2/c10-5-3-6(11)9-4(8-5)1-2-7-9/h1-2H,3H2,(H,8,10) |
InChiKey: | InChIKey=WLKWWISJQDPNNJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.