* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHOXY-4(5H)-THIAZOLONE |
CAS: | 67309-77-7 |
English Synonyms: | 2-ETHOXY-4(5H)-THIAZOLONE ; 2-ETHOXY-4,5-DIHYDRO-1,3-THIAZOL-4-ONE |
MDL Number.: | MFCD13184163 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCOC1=NC(=O)CS1 |
InChi: | InChI=1S/C5H7NO2S/c1-2-8-5-6-4(7)3-9-5/h2-3H2,1H3 |
InChiKey: | InChIKey=XFHCSRNNQKPHMZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.