* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-MET-ARG-PHE-OH |
CAS: | 67368-25-6 |
English Synonyms: | H-MET-ARG-PHE-OH |
MDL Number.: | MFCD00038568 |
H bond acceptor: | 10 |
H bond donor: | 7 |
Smile: | CSCC[C@@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)N |
InChi: | InChI=1S/C20H32N6O4S/c1-31-11-9-14(21)17(27)25-15(8-5-10-24-20(22)23)18(28)26-16(19(29)30)12-13-6-3-2-4-7-13/h2-4,6-7,14-16H,5,8-12,21H2,1H3,(H,25,27)(H,26,28)(H,29,30)(H4,22,23,24)/t14-,15-,16-/m0/s1 |
InChiKey: | InChIKey=OBVHKUFUDCPZDW-JYJNAYRXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.