* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3-INDOLIZINYL)-1-PROPANONE |
CAS: | 675139-29-4 |
English Synonyms: | 1-(3-INDOLIZINYL)-1-PROPANONE ; 1-(INDOLIZIN-3-YL)PROPAN-1-ONE |
MDL Number.: | MFCD12924524 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(=O)c1ccc2n1cccc2 |
InChi: | InChI=1S/C11H11NO/c1-2-11(13)10-7-6-9-5-3-4-8-12(9)10/h3-8H,2H2,1H3 |
InChiKey: | InChIKey=IWSIQOYRPBJYOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.