* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DIOSBULBIN G |
CAS: | 67567-15-1 |
English Synonyms: | DIOSBULBIN G |
MDL Number.: | MFCD17214899 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C[C@@]12C[C@H](OC(=O)[C@H]1C[C@H]3[C@H]4[C@H]2C[C@H](C[C@H]4C(=O)O3)O)c5ccoc5 |
InChi: | InChI=1S/C19H22O6/c1-19-7-15(9-2-3-23-8-9)25-18(22)13(19)6-14-16-11(17(21)24-14)4-10(20)5-12(16)19/h2-3,8,10-16,20H,4-7H2,1H3/t10-,11+,12+,13+,14-,15-,16+,19-/m0/s1 |
InChiKey: | InChIKey=GFUMUSWDMNZQDZ-HXKCJTCDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.