* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-10-1138 |
| CAS: | 676438-98-5 |
| English Synonyms: | ABBYPHARMA AP-10-1138 |
| MDL Number.: | MFCD16987900 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1=C(NC(=S)N=C1)C(F)(F)F |
| InChi: | InChI=1S/C8H7F3N2O2S/c1-2-15-6(14)4-3-12-7(16)13-5(4)8(9,10)11/h3H,2H2,1H3,(H,12,13,16) |
| InChiKey: | InChIKey=YVOZRBINFRMMKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.