* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABT-279 |
CAS: | 676559-83-4 |
English Synonyms: | ABT-279 |
MDL Number.: | MFCD09832685 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CC1(CCN(CC1)c2cc(ccn2)C(=O)O)NCC(=O)N3[C@H](CC[C@H]3C#N)C#C |
InChi: | InChI=1S/C21H25N5O3/c1-3-16-4-5-17(13-22)26(16)19(27)14-24-21(2)7-10-25(11-8-21)18-12-15(20(28)29)6-9-23-18/h1,6,9,12,16-17,24H,4-5,7-8,10-11,14H2,2H3,(H,28,29)/t16-,17-/m0/s1 |
InChiKey: | InChIKey=FIMRNLAKAARHPD-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.