* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3R)-3-ETHYL-2,3-DIHYDRO-1H-ISOINDOL-1-ONE |
CAS: | 677009-80-2 |
English Synonyms: | (3R)-3-ETHYL-2,3-DIHYDRO-1H-ISOINDOL-1-ONE |
MDL Number.: | MFCD12924523 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC[C@@H]1c2ccccc2C(=O)N1 |
InChi: | InChI=1S/C10H11NO/c1-2-9-7-5-3-4-6-8(7)10(12)11-9/h3-6,9H,2H2,1H3,(H,11,12)/t9-/m1/s1 |
InChiKey: | InChIKey=JEADTHISNZSTFP-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.