* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Hydroxybut-2-enoic acid |
CAS: | 67784-09-2 |
English Synonyms: | 2-HYDROXYBUT-2-ENOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OC(C(=O)O)=CC |
InChi: | InChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2,5H,1H3,(H,6,7) |
InChiKey: | InChIKey=RTWLEDIMOQVWDF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.