* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (6S)-6-(1-METHYLETHENYL)-2-PIPERIDINONE |
CAS: | 678163-53-6 |
English Synonyms: | (6S)-6-(1-METHYLETHENYL)-2-PIPERIDINONE |
MDL Number.: | MFCD13178727 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(=C)[C@@H]1CCCC(=O)N1 |
InChi: | InChI=1S/C8H13NO/c1-6(2)7-4-3-5-8(10)9-7/h7H,1,3-5H2,2H3,(H,9,10)/t7-/m0/s1 |
InChiKey: | InChIKey=SSRZPQDLDZMCJM-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.