* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-1H-PYRROLO[3,2-D]PYRIMIDINE-2,4(3H,5H)-DIONE |
CAS: | 67855-90-7 |
English Synonyms: | 7-METHYL-1H-PYRROLO[3,2-D]PYRIMIDINE-2,4(3H,5H)-DIONE |
MDL Number.: | MFCD13183829 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | Cc1c[nH]c2c1[nH]c(=O)[nH]c2=O |
InChi: | InChI=1S/C7H7N3O2/c1-3-2-8-5-4(3)9-7(12)10-6(5)11/h2,8H,1H3,(H2,9,10,11,12) |
InChiKey: | InChIKey=NOVWLZKMSUVARK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.