* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ETHYL-2,3-DIHYDRO-1H-INDEN-1-OL |
CAS: | 67864-73-7 |
English Synonyms: | 4-ETHYL-2,3-DIHYDRO-1H-INDEN-1-OL ; 1H-INDEN-1-OL, 4-ETHYL-2,3-DIHYDRO- |
MDL Number.: | MFCD16746378 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCc1cccc2c1CCC2O |
InChi: | InChI=1S/C11H14O/c1-2-8-4-3-5-10-9(8)6-7-11(10)12/h3-5,11-12H,2,6-7H2,1H3 |
InChiKey: | InChIKey=UCIMZBKZWASBRO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.