* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MARTYNOSIDE |
CAS: | 67884-12-2 |
English Synonyms: | MARTYNOSIDE |
MDL Number.: | MFCD11111293 |
H bond acceptor: | 15 |
H bond donor: | 7 |
Smile: | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/c3ccc(c(c3)OC)O)CO)OCCc4ccc(c(c4)O)OC)O)O)O)O |
InChi: | InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-20(40-2)19(34)12-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)21(13-16)41-3/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1 |
InChiKey: | InChIKey=WLWAYPFRKDSFCL-CNMJWYMJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.