* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2-DIHYDRO-2-METHOXY-1-METHYL-3H-INDOL-3-ONE |
CAS: | 679427-27-1 |
English Synonyms: | 1,2-DIHYDRO-2-METHOXY-1-METHYL-3H-INDOL-3-ONE |
MDL Number.: | MFCD12924522 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CN1c2ccccc2C(=O)C1OC |
InChi: | InChI=1S/C10H11NO2/c1-11-8-6-4-3-5-7(8)9(12)10(11)13-2/h3-6,10H,1-2H3 |
InChiKey: | InChIKey=SPIVVSBYKFNXAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.