* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-ETHYL-3-(O-TOLYL)UREA |
| CAS: | 67961-70-0 |
| English Synonyms: | 3-ETHYL-1-(2-METHYLPHENYL)UREA ; 1-ETHYL-3-(O-TOLYL)UREA |
| MDL Number.: | MFCD00088910 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCNC(=O)Nc1ccccc1C |
| InChi: | InChI=1S/C10H14N2O/c1-3-11-10(13)12-9-7-5-4-6-8(9)2/h4-7H,3H2,1-2H3,(H2,11,12,13) |
| InChiKey: | InChIKey=NSRJDXXKOSLQKG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.