* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-DEOXY-D-ARABINOSE |
| CAS: | 67968-47-2 |
| English Synonyms: | 5-DEOXY-D-ARABINOSE |
| MDL Number.: | MFCD00038363 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | C[C@@H]1[C@H]([C@@H](C(O1)O)O)O |
| InChi: | InChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9-2/h2-8H,1H3/t2-,3-,4+,5?/m1/s1 |
| InChiKey: | InChIKey=MKMRBXQLEMYZOY-ZRMNMSDTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.