Molecular Structure:
CAS No.:
68019-66-9
Product Name.:
CCD No.:CCD00144916
Formula:C11 H11 N3 O3
MolWeight:233.226
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(13)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 1-(4-METHOXYBENZYL)-4-NITRO-1H-IMIDAZOLE |
| CAS： | 68019-66-9 |
| English Synonyms： | 1-(4-METHOXYBENZYL)-4-NITRO-1H-IMIDAZOLE |
| MDL Number.： | MFCD00607632 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | COc1ccc(cc1)Cn2cc(nc2)[N+](=O)[O-] |
| InChi： | InChI=1S/C11H11N3O3/c1-17-10-4-2-9(3-5-10)6-13-7-11(12-8-13)14(15)16/h2-5,7-8H,6H2,1H3 |
| InChiKey： | InChIKey=VAXHFZPLOZDEGZ-UHFFFAOYSA-N |
|
|
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
