* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7,8,9,9A-TETRAHYDRO-1H-PYRROLO[1,2-A]AZEPINE-1,5(6H)-DIONE |
CAS: | 680193-49-1 |
English Synonyms: | 1H-PYRROLO[1,2-A]AZEPINE-1,5(6H)-DIONE, 7,8,9,9A-TETRAHYDRO- ; 7,8,9,9A-TETRAHYDRO-1H-PYRROLO[1,2-A]AZEPINE-1,5(6H)-DIONE |
MDL Number.: | MFCD12964848 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C1CCC(=O)N2C=CC(=O)C2C1 |
InChi: | InChI=1S/C9H11NO2/c11-8-5-6-10-7(8)3-1-2-4-9(10)12/h5-7H,1-4H2 |
InChiKey: | InChIKey=QJKORGPJPTWQEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.