* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-ETHYLGRAMINE |
CAS: | 68234-56-0 |
English Synonyms: | 7-ETHYLGRAMINE |
MDL Number.: | MFCD11112026 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCc1cccc2c1[nH]cc2CN(C)C |
InChi: | InChI=1S/C13H18N2/c1-4-10-6-5-7-12-11(9-15(2)3)8-14-13(10)12/h5-8,14H,4,9H2,1-3H3 |
InChiKey: | InChIKey=VCIQZPPZZYVHCR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.