* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MALTORYZINE |
CAS: | 6826-42-2 |
English Synonyms: | MALTORYZINE |
MDL Number.: | MFCD01708988 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CC/C=C/C(=O)c1c(ccc(c1O)O)O |
InChi: | InChI=1S/C11H12O4/c1-2-3-4-7(12)10-8(13)5-6-9(14)11(10)15/h3-6,13-15H,2H2,1H3/b4-3+ |
InChiKey: | InChIKey=KLVWCQBDUHHWEE-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.