* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-4-butanoic acid, beta-amino- |
CAS: | 682804-78-0 |
English Synonyms: | [1,1'-BIPHENYL]-4-BUTANOIC ACID, BETA-AMINO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC(CC(=O)O)CC1=CC=C(C=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C16H17NO2/c17-15(11-16(18)19)10-12-6-8-14(9-7-12)13-4-2-1-3-5-13/h1-9,15H,10-11,17H2,(H,18,19) |
InChiKey: | InChIKey=IHXITIQUZBCIHA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.