* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ETHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-AMINE |
CAS: | 685522-72-9 |
English Synonyms: | 1-ETHYL-1H-PYRAZOLO[3,4-B]PYRIDIN-3-AMINE |
MDL Number.: | MFCD16619992 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCn1c2c(cccn2)c(n1)N |
InChi: | InChI=1S/C8H10N4/c1-2-12-8-6(7(9)11-12)4-3-5-10-8/h3-5H,2H2,1H3,(H2,9,11) |
InChiKey: | InChIKey=MWENHVWUMJJKPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.