* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EUPATORIOPICRINE |
| CAS: | 6856-01-5 |
| English Synonyms: | EUPATORIOPICRINE |
| MDL Number.: | MFCD01725518 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C/C/1=C\[C@@H]2[C@@H]([C@@H](C/C(=C\CC1)/C)OC(=O)/C(=C/CO)/CO)C(=C)C(=O)O2 |
| InChi: | InChI=1S/C20H26O6/c1-12-5-4-6-13(2)10-17(26-20(24)15(11-22)7-8-21)18-14(3)19(23)25-16(18)9-12/h6-7,9,16-18,21-22H,3-5,8,10-11H2,1-2H3/b12-9+,13-6-,15-7+/t16-,17-,18+/m1/s1 |
| InChiKey: | InChIKey=VWJYWGYJIDQUEG-UWRPYMCXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.