* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHYL-3,9-DIHYDROXY-PHENALEN-1-ONE |
CAS: | 685889-42-3 |
English Synonyms: | 2-ETHYL-3,9-DIHYDROXY-PHENALEN-1-ONE |
MDL Number.: | MFCD00100716 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCC1=C(c2cccc3c2c(c(cc3)O)C1=O)O |
InChi: | InChI=1S/C15H12O3/c1-2-9-14(17)10-5-3-4-8-6-7-11(16)13(12(8)10)15(9)18/h3-7,16-17H,2H2,1H3 |
InChiKey: | InChIKey=YYKAXSDDZHFBCE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.