* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BENZYL-7-METHYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
CAS: | 686264-90-4 |
English Synonyms: | 1-BENZYL-7-METHYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
MDL Number.: | MFCD17011912 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(n1)n(c(=O)oc2=O)Cc3ccccc3 |
InChi: | InChI=1S/C15H12N2O3/c1-10-7-8-12-13(16-10)17(15(19)20-14(12)18)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3 |
InChiKey: | InChIKey=AEDRACQGOSWAFL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.