* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XANTHOPLANINE |
| CAS: | 6872-88-4 |
| English Synonyms: | XANTHOPLANINE |
| MDL Number.: | MFCD20260929 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C[N+]1(CCc2cc(c(c-3c2[C@@H]1Cc4c3cc(c(c4)O)OC)OC)OC)C |
| InChi: | InChI=1S/C21H25NO4/c1-22(2)7-6-12-10-18(25-4)21(26-5)20-14-11-17(24-3)16(23)9-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/p+1/t15-/m0/s1 |
| InChiKey: | InChIKey=FGUCOPALAZXICJ-HNNXBMFYSA-O |
* If the product has intellectual property rights, a license granted is must or contact us.