* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-HEXEN-3-OL |
CAS: | 688-99-3 |
English Synonyms: | 5-HEXEN-3-OL ; HEX-5-EN-3-OL ; 1-HEXENE-4-OL |
MDL Number.: | MFCD00021923 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(CC=C)O |
InChi: | InChI=1S/C6H12O/c1-3-5-6(7)4-2/h3,6-7H,1,4-5H2,2H3 |
InChiKey: | InChIKey=UOGFCIYBLKSQHL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.