Molecular Structure:
CAS No.:
688363-73-7
Product Name.:
CCD No.:CCD00736028
Formula:C10 H10 Br N O2
MolWeight:256.098
![8-BROMO-2,2-DIMETHYL-4H-BENZO[1,4]OXAZIN-3-ONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 8-BROMO-2,2-DIMETHYL-4H-BENZO[1,4]OXAZIN-3-ONE |
| CAS： | 688363-73-7 |
| English Synonyms： | 8-BROMO-2,2-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE ; 8-BROMO-2,2-DIMETHYL-4H-BENZO[1,4]OXAZIN-3-ONE |
| MDL Number.： | MFCD09261263 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | CC1(C(=O)Nc2cccc(c2O1)Br)C |
| InChi： | InChI=1S/C10H10BrNO2/c1-10(2)9(13)12-7-5-3-4-6(11)8(7)14-10/h3-5H,1-2H3,(H,12,13) |
| InChiKey： | InChIKey=ZYPVSNYNICRCNG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
