* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZOCAINONE |
| CAS: | 68876-74-4 |
| English Synonyms: | ZOCAINONE |
| MDL Number.: | MFCD00869140 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCN(CC)CCOc1ccccc1O/C(=C/c2ccccc2)/C(=O)C |
| InChi: | InChI=1S/C22H27NO3/c1-4-23(5-2)15-16-25-20-13-9-10-14-21(20)26-22(18(3)24)17-19-11-7-6-8-12-19/h6-14,17H,4-5,15-16H2,1-3H3/b22-17+ |
| InChiKey: | InChIKey=RQLBJLHRLMDUGQ-OQKWZONESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.